| Name | 1-Phenylpiperazine |
| Synonyms | 1-Fenylpiperazin AKOS BBS-00003581 1-Phenylpiperazine 1-PHENYLPIPERAZINE N-PHENYLPIPERAZINE TIMTEC-BB SBB003943 N-phenyl piperazine LABOTEST-BB LTBB000705 4-phenylpiperazin-1-ium Levodropropizine EP Impurity B |
| CAS | 92-54-6 |
| EINECS | 202-165-6 |
| InChI | InChI=1/C10H14N2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12/h1-5,11H,6-9H2/p+1 |
| Molecular Formula | C10H14N2 |
| Molar Mass | 162.23 |
| Density | 1.062g/mLat 25°C(lit.) |
| Melting Point | 18.8 °C |
| Boling Point | 286°C(lit.) |
| Flash Point | >230°F |
| Water Solubility | Insoluble |
| Solubility | Insoluble |
| Vapor Presure | 0.00252mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.062 (20/4℃) |
| Color | Clear colorless to yellow |
| BRN | 132157 |
| pKa | pK1:8.71(+1) (25°C,μ=0.1) |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.588(lit.) |
| Use | Intermediates of levodropropizine |
| Risk Codes | R22 - Harmful if swallowed R24 - Toxic in contact with skin R34 - Causes burns R36/37/38 - Irritating to eyes, respiratory system and skin. R23/24/25 - Toxic by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S28A - |
| UN IDs | UN 2922 8/PG 2 |
| WGK Germany | 3 |
| RTECS | TM2625000 |
| TSCA | Yes |
| HS Code | 29335995 |
| Hazard Note | Toxic/Corrosive |
| Hazard Class | 6.1 |
| Packing Group | II |